cas: 132089-32-8 — see every product listed under this CAS number, including other names
Ethyl 2-(p-tolyl)thiazole-4-carboxylate, 96% (CAS 132089-32-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217763-1G |
| cas | 132089-32-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1122.54 Pln | |
| Fluorochem | 10g | 1903.51 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate (CAS 132089-32-8) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: ethyl 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate. InChIKey: YJADELKTGPHXGE-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | ethyl 2-(4-methylphenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | YJADELKTGPHXGE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)