Products 132089-33-9
CAS 132089-33-9 appears in our catalog under these names: 2-M-Tolyl-thiazole-4-carboxylic acid ethyl ester, 98%, Ethyl 2-(m-tolyl)thiazole-4-carboxylate, 98%, 2-m-Tolyl-thiazole-4-carboxylic acid ethyl ester, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100mg.
Ethyl 2-(3-methylphenyl)-1,3-thiazole-4-carboxylate (CAS 132089-33-9) is a chemical compound with the molecular formula C13H13NO2S and a molecular weight of 247.31 g/mol. IUPAC name: ethyl 2-(3-methylphenyl)-1,3-thiazole-4-carboxylate. InChIKey: LQCPJZNCZBKRBX-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2S |
|---|---|
| Molecular weight | 247.31 g/mol |
| IUPAC name | ethyl 2-(3-methylphenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | LQCPJZNCZBKRBX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)