cas: 1012881-37-6 — see every product listed under this CAS number, including other names
Ethyl 2-(tert-butyl)thiazole-5-carboxylate 97% (CAS 1012881-37-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A182930-50mg |
| cas | 1012881-37-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 704.12 Pln | |
| Ambeed | 100mg | 1093.50 Pln | |
| Ambeed | 250mg | 2039.12 Pln | |
| Ambeed | 1g | 4965.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A182930 |
Ethyl 2-tert-butyl-1,3-thiazole-5-carboxylate (CAS 1012881-37-6) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: ethyl 2-tert-butyl-1,3-thiazole-5-carboxylate. InChIKey: KZJMIYNMRNUMFW-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | ethyl 2-tert-butyl-1,3-thiazole-5-carboxylate |
| InChIKey | KZJMIYNMRNUMFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(S1)C(C)(C)C |
Computed by PubChem (NCBI)