CAS 64732-36-1 appears in our catalog under these names: [4-(Propan-2-yl)phenyl]methanesulfonamide, 95%, (4-(Propan-2-yl)phenyl)methanesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
(4-propan-2-ylphenyl)methanesulfonamide (CAS 64732-36-1) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: (4-propan-2-ylphenyl)methanesulfonamide. InChIKey: QUHGEDDAENKRCA-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | (4-propan-2-ylphenyl)methanesulfonamide |
| InChIKey | QUHGEDDAENKRCA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CS(=O)(=O)N |
Computed by PubChem (NCBI)