CAS 350988-44-2 is the registry number for Isopropyl 2-amino-4,5-dimethylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Propan-2-yl 2-amino-4,5-dimethylthiophene-3-carboxylate (CAS 350988-44-2) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: propan-2-yl 2-amino-4,5-dimethylthiophene-3-carboxylate. InChIKey: PXWXBFMFSLKMJA-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | propan-2-yl 2-amino-4,5-dimethylthiophene-3-carboxylate |
| InChIKey | PXWXBFMFSLKMJA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)OC(C)C)N)C |
Computed by PubChem (NCBI)