CAS 51770-72-0 appears in our catalog under these names: 4-(Butane-1-sulfonyl)aniline, 97%, 4-(Butylsulfonyl)aniline, 98%, 98%, 4-(Butylsulfonyl)aniline, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
4-butylsulfonylaniline (CAS 51770-72-0) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: 4-butylsulfonylaniline. InChIKey: HBNSCBAEYVWNNV-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | 4-butylsulfonylaniline |
| InChIKey | HBNSCBAEYVWNNV-UHFFFAOYSA-N |
| SMILES | CCCCS(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)