cas: 307511-65-5 — see every product listed under this CAS number, including other names
Ethyl 2-Amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate, 95%, 95% (CAS 307511-65-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11425R-100mg |
| cas | 307511-65-5 |
| size | 100mg |
| availability | 4.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 693.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate (CAS 307511-65-5) is a chemical compound with the molecular formula C15H17NO2S and a molecular weight of 275.4 g/mol. IUPAC name: ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate. InChIKey: KLIHUUITIBDJMQ-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2S |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | ethyl 2-amino-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
| InChIKey | KLIHUUITIBDJMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC=C1C2=CC(=C(C=C2)C)C)N |
Computed by PubChem (NCBI)