CAS 350997-35-2 is the registry number for Ethyl 2-amino-5-methyl-4-(4-methylphenyl)thiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Ethyl 2-amino-5-methyl-4-(4-methylphenyl)thiophene-3-carboxylate (CAS 350997-35-2) is a chemical compound with the molecular formula C15H17NO2S and a molecular weight of 275.4 g/mol. IUPAC name: ethyl 2-amino-5-methyl-4-(4-methylphenyl)thiophene-3-carboxylate. InChIKey: UFBPTRLHPVERBQ-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2S |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | ethyl 2-amino-5-methyl-4-(4-methylphenyl)thiophene-3-carboxylate |
| InChIKey | UFBPTRLHPVERBQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1C2=CC=C(C=C2)C)C)N |
Computed by PubChem (NCBI)