Products 863669-59-4

CAS 863669-59-4 is the registry number for 1-(1,3-Benzothiazol-2-ylmethyl)cyclohexanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(1,3-benzothiazol-2-ylmethyl)cyclohexane-1-carboxylic acid (CAS 863669-59-4) is a chemical compound with the molecular formula C15H17NO2S and a molecular weight of 275.4 g/mol. IUPAC name: 1-(1,3-benzothiazol-2-ylmethyl)cyclohexane-1-carboxylic acid. InChIKey: VZNVKRYUHBRZPB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO2S
Molecular weight275.4 g/mol
IUPAC name1-(1,3-benzothiazol-2-ylmethyl)cyclohexane-1-carboxylic acid
InChIKeyVZNVKRYUHBRZPB-UHFFFAOYSA-N
SMILESC1CCC(CC1)(CC2=NC3=CC=CC=C3S2)C(=O)O

Computed by PubChem (NCBI)