CAS 433245-13-7 appears in our catalog under these names: 2-(2,5-Dimethyl-1h-pyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid, 95%, 2-(2,5-Dimethyl-pyrrol-1-yl)-4,5,6,7-tetrahydro-benzo[ b ]thiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g.
2-(2,5-dimethylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (CAS 433245-13-7) is a chemical compound with the molecular formula C15H17NO2S and a molecular weight of 275.4 g/mol. IUPAC name: 2-(2,5-dimethylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid. InChIKey: SJKZSURXGGPPSD-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2S |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | 2-(2,5-dimethylpyrrol-1-yl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| InChIKey | SJKZSURXGGPPSD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=C(C3=C(S2)CCCC3)C(=O)O)C |
Computed by PubChem (NCBI)