cas: 1147107-15-0 — see every product listed under this CAS number, including other names
Ethyl 2-amino-4,6-difluorobenzoate, 95%, 95% (CAS 1147107-15-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111F3O-100mg |
| cas | 1147107-15-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 851.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-4,6-difluorobenzoate (CAS 1147107-15-0) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: ethyl 2-amino-4,6-difluorobenzoate. InChIKey: UQVMTSBAMCLIPD-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | ethyl 2-amino-4,6-difluorobenzoate |
| InChIKey | UQVMTSBAMCLIPD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1F)F)N |
Computed by PubChem (NCBI)