cas: 1147107-15-0 — see every product listed under this CAS number, including other names
Ethyl 2-amino-4,6-difluorobenzoate, 97% (CAS 1147107-15-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F363882-100MG |
| cas | 1147107-15-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 1185.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-amino-4,6-difluorobenzoate (CAS 1147107-15-0) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: ethyl 2-amino-4,6-difluorobenzoate. InChIKey: UQVMTSBAMCLIPD-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | ethyl 2-amino-4,6-difluorobenzoate |
| InChIKey | UQVMTSBAMCLIPD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1F)F)N |
Computed by PubChem (NCBI)