Products 1134619-17-2
CAS 1134619-17-2 appears in our catalog under these names: 2-Amino-2-(2,5-difluorophenyl)propanoic acid, 2-Amino-2-(2,5-difluorophenyl)propanoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
2-amino-2-(2,5-difluorophenyl)propanoic acid (CAS 1134619-17-2) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 2-amino-2-(2,5-difluorophenyl)propanoic acid. InChIKey: XVZWLQXESCERMO-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 2-amino-2-(2,5-difluorophenyl)propanoic acid |
| InChIKey | XVZWLQXESCERMO-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)F)F)(C(=O)O)N |
Computed by PubChem (NCBI)