Products 1192660-36-8
CAS 1192660-36-8 appears in our catalog under these names: 2-(2,5-Difluorophenyl)-2-(methylamino)acetic acid, 95%, 2-(2,5-Difluorophenyl)-2-(methylamino)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
2-(2,5-difluorophenyl)-2-(methylamino)acetic acid (CAS 1192660-36-8) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 2-(2,5-difluorophenyl)-2-(methylamino)acetic acid. InChIKey: CKSBJYFSKSPAMJ-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 2-(2,5-difluorophenyl)-2-(methylamino)acetic acid |
| InChIKey | CKSBJYFSKSPAMJ-UHFFFAOYSA-N |
| SMILES | CNC(C1=C(C=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)