cas: 1205561-31-4 — see every product listed under this CAS number, including other names
Ethyl 2-amino-4-cyclopropylthiazole-5-carboxylate, 98%, 98% (CAS 1205561-31-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DJT5-100mg |
| cas | 1205561-31-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1043.60 Pln | |
| Chemat | 250mg | 1710.80 Pln | |
| Chemat | 1g | 4475.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-4-cyclopropyl-1,3-thiazole-5-carboxylate (CAS 1205561-31-4) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: ethyl 2-amino-4-cyclopropyl-1,3-thiazole-5-carboxylate. InChIKey: WWOBXWRMODSKOF-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | ethyl 2-amino-4-cyclopropyl-1,3-thiazole-5-carboxylate |
| InChIKey | WWOBXWRMODSKOF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)N)C2CC2 |
Computed by PubChem (NCBI)