cas: 1806511-07-8 — see every product listed under this CAS number, including other names
Ethyl 2-amino-5-fluoronicotinate, 98% (CAS 1806511-07-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546685-100MG |
| cas | 1806511-07-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 138.51 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 732.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-amino-5-fluoropyridine-3-carboxylate (CAS 1806511-07-8) is a chemical compound with the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. IUPAC name: ethyl 2-amino-5-fluoropyridine-3-carboxylate. InChIKey: CBWWBCIOCIMACS-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O2 |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | ethyl 2-amino-5-fluoropyridine-3-carboxylate |
| InChIKey | CBWWBCIOCIMACS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)F)N |
Computed by PubChem (NCBI)