CAS 379255-56-8 appears in our catalog under these names: 2-(3-Fluorophenoxy)acetohydrazide, 98%, 2-(3-Fluorophenoxy)acetohydrazide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 5g, 1g.
2-(3-fluorophenoxy)acetohydrazide (CAS 379255-56-8) is a chemical compound with the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. IUPAC name: 2-(3-fluorophenoxy)acetohydrazide. InChIKey: FRMANOVQPAYLFV-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O2 |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 2-(3-fluorophenoxy)acetohydrazide |
| InChIKey | FRMANOVQPAYLFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OCC(=O)NN |
Computed by PubChem (NCBI)