CAS 65739-04-0 is the registry number for 2-Fluoro-N,N-dimethyl-4-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
2-fluoro-N,N-dimethyl-4-nitroaniline (CAS 65739-04-0) is a chemical compound with the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. IUPAC name: 2-fluoro-N,N-dimethyl-4-nitroaniline. InChIKey: QTXUWCWOGLFTTP-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O2 |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | 2-fluoro-N,N-dimethyl-4-nitroaniline |
| InChIKey | QTXUWCWOGLFTTP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)