CAS 403712-67-4 appears in our catalog under these names: Methyl 2,3-diamino-6-fluorobenzoate, 95%, Methyl 2,3-diamino-6-fluorobenzoate 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2,3-diamino-6-fluorobenzoate (CAS 403712-67-4) is a chemical compound with the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. IUPAC name: methyl 2,3-diamino-6-fluorobenzoate. InChIKey: KFTFTXAANFTSOF-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O2 |
|---|---|
| Molecular weight | 184.17 g/mol |
| IUPAC name | methyl 2,3-diamino-6-fluorobenzoate |
| InChIKey | KFTFTXAANFTSOF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1N)N)F |
Computed by PubChem (NCBI)