cas: 42783-04-0 — see every product listed under this CAS number, including other names
Ethyl 2-amino-5-nitrothiophene-3-carboxylate, 95% (CAS 42783-04-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F440522-100MG |
| cas | 42783-04-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 888.25 Pln | |
| Fluorochem | 250mg | 1565.09 Pln | |
| Fluorochem | 1g | 3840.33 Pln | |
| Fluorochem | 500mg | 2439.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-amino-5-nitrothiophene-3-carboxylate (CAS 42783-04-0) is a chemical compound with the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. IUPAC name: ethyl 2-amino-5-nitrothiophene-3-carboxylate. InChIKey: UXDKVBJDZDRIKL-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4S |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | ethyl 2-amino-5-nitrothiophene-3-carboxylate |
| InChIKey | UXDKVBJDZDRIKL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)