CAS 1820748-73-9 is the registry number for 2-[(Thiazolidin-2-ylidene)aminomethylidene]malonic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methylidene]propanedioic acid (CAS 1820748-73-9) is a chemical compound with the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. IUPAC name: 2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methylidene]propanedioic acid. InChIKey: CYBJMBDYGDZDLY-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4S |
|---|---|
| Molecular weight | 216.22 g/mol |
| IUPAC name | 2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methylidene]propanedioic acid |
| InChIKey | CYBJMBDYGDZDLY-UHFFFAOYSA-N |
| SMILES | C1CSC(=N1)NC=C(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)