Products 1820748-73-9

CAS 1820748-73-9 is the registry number for 2-[(Thiazolidin-2-ylidene)aminomethylidene]malonic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methylidene]propanedioic acid (CAS 1820748-73-9) is a chemical compound with the molecular formula C7H8N2O4S and a molecular weight of 216.22 g/mol. IUPAC name: 2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methylidene]propanedioic acid. InChIKey: CYBJMBDYGDZDLY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O4S
Molecular weight216.22 g/mol
IUPAC name2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methylidene]propanedioic acid
InChIKeyCYBJMBDYGDZDLY-UHFFFAOYSA-N
SMILESC1CSC(=N1)NC=C(C(=O)O)C(=O)O

Computed by PubChem (NCBI)