cas: 96334-44-0 — see every product listed under this CAS number, including other names
Ethyl 2-amino-7-oxo-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate, 98%, 98% (CAS 96334-44-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJSU-1g |
| cas | 96334-44-0 |
| size | 1g |
| availability | 88.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 448.40 Pln | |
| Chemat | 10g | 765.20 Pln | |
| Chemat | 25g | 1754.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-amino-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate (CAS 96334-44-0) is a chemical compound with the molecular formula C11H13NO3S and a molecular weight of 239.29 g/mol. IUPAC name: ethyl 2-amino-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate. InChIKey: KHNVFGZAADIYSH-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3S |
|---|---|
| Molecular weight | 239.29 g/mol |
| IUPAC name | ethyl 2-amino-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
| InChIKey | KHNVFGZAADIYSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC2=C1CCCC2=O)N |
Computed by PubChem (NCBI)