cas: 1131040-49-7 — see every product listed under this CAS number, including other names
Ethyl 2-bromo-3-fluorobenzoate (CAS 1131040-49-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F097681-5G |
| cas | 1131040-49-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1200.64 Pln | |
| Fluorochem | 10g | 1997.23 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 2-bromo-3-fluorobenzoate (CAS 1131040-49-7) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: ethyl 2-bromo-3-fluorobenzoate. InChIKey: JCKZDYSLKOUKTG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | ethyl 2-bromo-3-fluorobenzoate |
| InChIKey | JCKZDYSLKOUKTG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)F)Br |
Computed by PubChem (NCBI)