cas: 1208075-44-8 — see every product listed under this CAS number, including other names
Ethyl 2-bromo-5-iodobenzoate 96% (CAS 1208075-44-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A490624-250mg |
| cas | 1208075-44-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1010.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A490624 |
Ethyl 2-bromo-5-iodobenzoate (CAS 1208075-44-8) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: ethyl 2-bromo-5-iodobenzoate. InChIKey: AESBDCQWLOZBNY-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | ethyl 2-bromo-5-iodobenzoate |
| InChIKey | AESBDCQWLOZBNY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)I)Br |
Computed by PubChem (NCBI)