cas: 1208075-44-8 — see every product listed under this CAS number, including other names
Ethyl 2-Bromo-5-iodobenzoate, 97% (CAS 1208075-44-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038734-1G |
| cas | 1208075-44-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 810.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-bromo-5-iodobenzoate (CAS 1208075-44-8) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: ethyl 2-bromo-5-iodobenzoate. InChIKey: AESBDCQWLOZBNY-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | ethyl 2-bromo-5-iodobenzoate |
| InChIKey | AESBDCQWLOZBNY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)I)Br |
Computed by PubChem (NCBI)