cas: 108381-23-3 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate 98% (CAS 108381-23-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A424632-100mg |
| cas | 108381-23-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 2322.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A424632 |
Ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate (CAS 108381-23-3) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate. InChIKey: QWWCHVHQVYFMJU-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate |
| InChIKey | QWWCHVHQVYFMJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(N=C1C)Cl)C |
Computed by PubChem (NCBI)