cas: 108381-23-3 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate, 98%, 98% (CAS 108381-23-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HB76-100mg |
| cas | 108381-23-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 2061.20 Pln | |
| Chemat | 10g | 4062.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate (CAS 108381-23-3) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate. InChIKey: QWWCHVHQVYFMJU-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | ethyl 2-chloro-4,6-dimethylpyrimidine-5-carboxylate |
| InChIKey | QWWCHVHQVYFMJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(N=C1C)Cl)C |
Computed by PubChem (NCBI)