cas: 474709-76-7 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98% (CAS 474709-76-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F228702-1G |
| cas | 474709-76-7 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 1148.57 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 1115.75 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1235.60 Pln | |
| Chemat | 25g | 2680.40 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Ethyl 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 474709-76-7) is a chemical compound with the molecular formula C15H20BClO4 and a molecular weight of 310.6 g/mol. IUPAC name: ethyl 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: GYLSDPPQNVGXBD-UHFFFAOYSA-N.
| Molecular formula | C15H20BClO4 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | ethyl 2-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | GYLSDPPQNVGXBD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OCC)Cl |
Computed by PubChem (NCBI)