CAS 2032371-79-0 appears in our catalog under these names: 4-Chloro-2-ethoxycarbonylphenylboronic acid pinacol ester, 96%, Ethyl 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate 96%, 4-CHLORO-2-ETHOXYCARBONYLPHENYLBORONIC ACID PINACOL ESTER, 96%, 96%, Ethyl 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
Ethyl 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2032371-79-0) is a chemical compound with the molecular formula C15H20BClO4 and a molecular weight of 310.6 g/mol. IUPAC name: ethyl 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: VELRTBIZGRFHMS-UHFFFAOYSA-N.
| Molecular formula | C15H20BClO4 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | ethyl 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | VELRTBIZGRFHMS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)C(=O)OCC |
Computed by PubChem (NCBI)