CAS 2639387-25-8 is the registry number for Methyl 3-chloro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-chloro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2639387-25-8) is a chemical compound with the molecular formula C15H20BClO4 and a molecular weight of 310.6 g/mol. IUPAC name: methyl 3-chloro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: UJTBXBAXEWDBLR-UHFFFAOYSA-N.
| Molecular formula | C15H20BClO4 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | methyl 3-chloro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | UJTBXBAXEWDBLR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2C)Cl)C(=O)OC |
Computed by PubChem (NCBI)