CAS 2304634-54-4 appears in our catalog under these names: 2-(Acetoxymethyl)-6-chlorophenylboronic acid pinacol ester, 95%, 2-(Acetoxymethyl)-6-chlorophenylboronic Acid Pinacol Ester, ≥95%, ≥95%, 3-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl acetate. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[3-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate (CAS 2304634-54-4) is a chemical compound with the molecular formula C15H20BClO4 and a molecular weight of 310.6 g/mol. IUPAC name: [3-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate. InChIKey: KEYPTOOCEBHZGG-UHFFFAOYSA-N.
| Molecular formula | C15H20BClO4 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | [3-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl acetate |
| InChIKey | KEYPTOOCEBHZGG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2Cl)COC(=O)C |
Computed by PubChem (NCBI)