cas: 151322-83-7 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-5-nitronicotinate 97% (CAS 151322-83-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A821918-250mg |
| cas | 151322-83-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 1755.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A821918 |
Ethyl 2-chloro-5-nitropyridine-3-carboxylate (CAS 151322-83-7) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: ethyl 2-chloro-5-nitropyridine-3-carboxylate. InChIKey: OXOWYVJYDSTHGX-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | ethyl 2-chloro-5-nitropyridine-3-carboxylate |
| InChIKey | OXOWYVJYDSTHGX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)