cas: 151322-83-7 — see every product listed under this CAS number, including other names
Ethyl 2-chloro-5-nitronicotinate, 97%, 97% (CAS 151322-83-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112NAB-100mg |
| cas | 151322-83-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 328.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-chloro-5-nitropyridine-3-carboxylate (CAS 151322-83-7) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: ethyl 2-chloro-5-nitropyridine-3-carboxylate. InChIKey: OXOWYVJYDSTHGX-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | ethyl 2-chloro-5-nitropyridine-3-carboxylate |
| InChIKey | OXOWYVJYDSTHGX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)