cas: 27124-44-3 — see every product listed under this CAS number, including other names
Ethyl 2-hydroxyimidazo[1,2-a]pyridine-3-carboxylate, 95%, 95% (CAS 27124-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CE73-100mg |
| cas | 27124-44-3 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 2704.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-hydroxyimidazo[1,2-a]pyridine-3-carboxylate (CAS 27124-44-3) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: ethyl 2-hydroxyimidazo[1,2-a]pyridine-3-carboxylate. InChIKey: PPTIMFGQTXQBRZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | ethyl 2-hydroxyimidazo[1,2-a]pyridine-3-carboxylate |
| InChIKey | PPTIMFGQTXQBRZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2N1C=CC=C2)O |
Computed by PubChem (NCBI)