Products 1267663-32-0
CAS 1267663-32-0 appears in our catalog under these names: 1,3-Dimethyl-6-hydroxyquinazoline-2,4-dione, 95%, 1,3-Dimethyl-6-hydroxyquinazoline-2,4-dione, 98%, 1，3–Dimethyl–6–hydroxyquinazoline–2，4–dione, 6-Hydroxy-1,3-dimethylquinazoline-2,4(1H,3H)-dione, ≥95%, ≥95%, 6-Hydroxy-1,3-dimethylquinazoline-2,4(1H,3H)-dione. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-hydroxy-1,3-dimethylquinazoline-2,4-dione (CAS 1267663-32-0) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 6-hydroxy-1,3-dimethylquinazoline-2,4-dione. InChIKey: AGHJHORNXUKEBY-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 6-hydroxy-1,3-dimethylquinazoline-2,4-dione |
| InChIKey | AGHJHORNXUKEBY-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)O)C(=O)N(C1=O)C |
Computed by PubChem (NCBI)