cas: 27124-44-3 — see every product listed under this CAS number, including other names
Ethyl 2-hydroxyimidazo[1,2-a]pyridine-3-carboxylate, 97% (CAS 27124-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F462421-100MG |
| cas | 27124-44-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 206.20 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 758.08 Pln | |
| Fluorochem | 10g | 7110.01 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-hydroxyimidazo[1,2-a]pyridine-3-carboxylate (CAS 27124-44-3) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: ethyl 2-hydroxyimidazo[1,2-a]pyridine-3-carboxylate. InChIKey: PPTIMFGQTXQBRZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | ethyl 2-hydroxyimidazo[1,2-a]pyridine-3-carboxylate |
| InChIKey | PPTIMFGQTXQBRZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2N1C=CC=C2)O |
Computed by PubChem (NCBI)