Products 99072-13-6

CAS 99072-13-6 is the registry number for 3-(1H-Benzimidazol-2-yl)-3-hydroxypropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(1H-benzimidazol-2-yl)-3-hydroxypropanoic acid (CAS 99072-13-6) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 3-(1H-benzimidazol-2-yl)-3-hydroxypropanoic acid. InChIKey: JXNVLFRNSKOUIE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O3
Molecular weight206.20 g/mol
IUPAC name3-(1H-benzimidazol-2-yl)-3-hydroxypropanoic acid
InChIKeyJXNVLFRNSKOUIE-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)NC(=N2)C(CC(=O)O)O

Computed by PubChem (NCBI)