Ethyl 3,4,5-trifluorobenzoate, 97%
cas: 495405-09-9 — see every product listed under this CAS number, including other names
Ethyl 3,4,5-trifluorobenzoate, 97% (CAS 495405-09-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A342600-1g |
| cas | 495405-09-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 604.00 Pln | |
| Ambeed | 500g | 2206.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 203.29 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 647.57 Pln | |
| BLDpharm | 500g | 2374.74 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 560.24 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 3,4,5-trifluorobenzoate (CAS 495405-09-9) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: ethyl 3,4,5-trifluorobenzoate. InChIKey: UWHPRVLGRIWCQQ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | ethyl 3,4,5-trifluorobenzoate |
| InChIKey | UWHPRVLGRIWCQQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)F)F)F |
Computed by PubChem (NCBI)