cas: 1256481-38-5 — see every product listed under this CAS number, including other names
Ethyl 3,5-dimethyl-4-fluorobenzoate (CAS 1256481-38-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630920-1G |
| cas | 1256481-38-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4787.92 Pln | |
| Fluorochem | 5g | 14216.89 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 4-fluoro-3,5-dimethylbenzoate (CAS 1256481-38-5) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: ethyl 4-fluoro-3,5-dimethylbenzoate. InChIKey: AMQMJNUHGJTCOW-UHFFFAOYSA-N.
| Molecular formula | C11H13FO2 |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | ethyl 4-fluoro-3,5-dimethylbenzoate |
| InChIKey | AMQMJNUHGJTCOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C)F)C |
Computed by PubChem (NCBI)