cas: 33877-05-3 — see every product listed under this CAS number, including other names
Ethyl 3-(2-methoxyphenyl)acrylate, 97% (E), 97% (E) (CAS 33877-05-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CUH3-250mg |
| cas | 33877-05-3 |
| size | 250mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 496.40 Pln |
| purity | 97% (E) |
|---|---|
| delivery time | 3 weeks |
Ethyl (E)-3-(2-methoxyphenyl)prop-2-enoate (CAS 33877-05-3) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: ethyl (E)-3-(2-methoxyphenyl)prop-2-enoate. InChIKey: ATAFSLBAINHGTN-CMDGGOBGSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | ethyl (E)-3-(2-methoxyphenyl)prop-2-enoate |
| InChIKey | ATAFSLBAINHGTN-CMDGGOBGSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=CC=C1OC |
Computed by PubChem (NCBI)