cas: 5462-13-5 — see every product listed under this CAS number, including other names
Ethyl 3-(3,4-dimethoxyphenyl)propionate 98% (CAS 5462-13-5) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A877307-25g |
| cas | 5462-13-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 2662.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A877307 |
Ethyl 3-(3,4-dimethoxyphenyl)propanoate (CAS 5462-13-5) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: ethyl 3-(3,4-dimethoxyphenyl)propanoate. InChIKey: GFAGDEMAMZYNAI-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | ethyl 3-(3,4-dimethoxyphenyl)propanoate |
| InChIKey | GFAGDEMAMZYNAI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)