Products 1781655-77-3
CAS 1781655-77-3 appears in our catalog under these names: 3–(3，5–Dimethoxyphenyl)–2，2–dimethylpropanoic acid, 3-(3,5-Dimethoxyphenyl)-2,2-dimethylpropanoic acid, 95%, 3-(3,5-Dimethoxyphenyl)-2,2-dimethylpropanoic acid, 95+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-(3,5-dimethoxyphenyl)-2,2-dimethylpropanoic acid (CAS 1781655-77-3) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 3-(3,5-dimethoxyphenyl)-2,2-dimethylpropanoic acid. InChIKey: OINQIUJXFLWJTJ-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 3-(3,5-dimethoxyphenyl)-2,2-dimethylpropanoic acid |
| InChIKey | OINQIUJXFLWJTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC(=CC(=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)