Products 56531-58-9
CAS 56531-58-9 appears in our catalog under these names: 3-(Carboxymethyl)adamantane-1-carboxylic acid, 95%, 3-Carboxymethyl-1-adamantane carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2g.
3-(carboxymethyl)adamantane-1-carboxylic acid (CAS 56531-58-9) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: 3-(carboxymethyl)adamantane-1-carboxylic acid. InChIKey: YQXJBYAQGPMUEP-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 3-(carboxymethyl)adamantane-1-carboxylic acid |
| InChIKey | YQXJBYAQGPMUEP-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Carboxyadamantane-1-acetic acid, 3-(carboxymethyl)adamantane-1-carboxylic acid, 3-Carboxymethyl-1-adamantane carboxylic acid, tricyclo[3.3.1.1~3,7~]decane-1-acetic acid, 3-carboxy-, Enamine_005944, 3-carboxymethyl adamantane-1-carboxylic acid, Oprea1_321214, 3-(carboxymethyl)adamantane-1-carboxylicacid