cas: 1736-31-8 — see every product listed under this CAS number, including other names
Ethyl 3-(4-fluorophenyl)propiolate, 95% (CAS 1736-31-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 500mg, 1g, 10g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A488946-5g |
| cas | 1736-31-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14287.84 Pln | |
| AmBeed | 50mg | 1007.44 Pln | |
| Fluorochem | 50mg | 674.78 Pln | |
| Fluorochem | 100mg | 981.96 Pln | |
| Fluorochem | 250mg | 1445.34 Pln | |
| Fluorochem | 500mg | 2101.36 Pln | |
| Fluorochem | 1g | 3132.25 Pln | |
| Fluorochem | 5g | 8994.77 Pln | |
| Fluorochem | 10g | 14097.14 Pln | |
| Chemat | 100mg | 774.80 Pln | |
| Chemat | 250mg | 1072.40 Pln | |
| Chemat | 1g | 2445.20 Pln | |
| Chemat | 5g | 7216.40 Pln | |
| Chemat | 10g | 10720.40 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 3-(4-fluorophenyl)prop-2-ynoate (CAS 1736-31-8) is a chemical compound with the molecular formula C11H9FO2 and a molecular weight of 192.19 g/mol. IUPAC name: ethyl 3-(4-fluorophenyl)prop-2-ynoate. InChIKey: APRILKFBGZRBKC-UHFFFAOYSA-N.
| Molecular formula | C11H9FO2 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | ethyl 3-(4-fluorophenyl)prop-2-ynoate |
| InChIKey | APRILKFBGZRBKC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C#CC1=CC=C(C=C1)F |
Computed by PubChem (NCBI)