cas: 224319-23-7 — see every product listed under this CAS number, including other names
Ethyl 3-(5-methylthiophen-2-yl)-3-oxopropanoate 97% (CAS 224319-23-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A780845-100mg |
| cas | 224319-23-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A780845 |
Ethyl 3-(5-methylthiophen-2-yl)-3-oxopropanoate (CAS 224319-23-7) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: ethyl 3-(5-methylthiophen-2-yl)-3-oxopropanoate. InChIKey: GJZZCAURPLNHGC-UHFFFAOYSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | ethyl 3-(5-methylthiophen-2-yl)-3-oxopropanoate |
| InChIKey | GJZZCAURPLNHGC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(S1)C |
Computed by PubChem (NCBI)