Products 57414-85-4
CAS 57414-85-4 appears in our catalog under these names: Ethyl 3-amino-2-methylbenzoate, 95%, Ethyl 3-Amino-2-methylbenzoate, >98.0%(GC)(T), Ethyl 3-Amino-2-methylbenzoate, 98+%, 98+%, Ethyl 3-amino-2-methylbenzoate, 98%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 100g.
Ethyl 3-amino-2-methylbenzoate (CAS 57414-85-4) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: ethyl 3-amino-2-methylbenzoate. InChIKey: RZDRJEHTKWQFQO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | ethyl 3-amino-2-methylbenzoate |
| InChIKey | RZDRJEHTKWQFQO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)N)C |
Computed by PubChem (NCBI)