cas: 52505-51-8 — see every product listed under this CAS number, including other names
Ethyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate, 95%, 95% (CAS 52505-51-8) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCUR-5mg |
| cas | 52505-51-8 |
| size | 5mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 218.00 Pln | |
| Chemat | 25mg | 530.00 Pln | |
| Chemat | 50mg | 918.80 Pln | |
| Chemat | 100mg | 1619.60 Pln | |
| Chemat | 250mg | 3174.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate (CAS 52505-51-8) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: ethyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate. InChIKey: KRCQFLONSCMKHX-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | ethyl 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylate |
| InChIKey | KRCQFLONSCMKHX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(S1)N=C(C=C2)C)N |
Computed by PubChem (NCBI)