CAS 103038-43-3 appears in our catalog under these names: ETHYL 3-BROMO-2-METHYLBENZOATE, 98%, Ethyl 3-bromo-2-methylbenzoate, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
Ethyl 3-bromo-2-methylbenzoate (CAS 103038-43-3) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: ethyl 3-bromo-2-methylbenzoate. InChIKey: ISZDEZLLBGJTTF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | ethyl 3-bromo-2-methylbenzoate |
| InChIKey | ISZDEZLLBGJTTF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)Br)C |
Computed by PubChem (NCBI)