CAS 147962-81-0 appears in our catalog under these names: Ethyl 3–bromo–4–methylbenzoate, Ethyl 3-Bromo-4-Methylbenzoate, 98%, 98%, Ethyl 3-bromo-4-methylbenzoate, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g.
Ethyl 3-bromo-4-methylbenzoate (CAS 147962-81-0) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: ethyl 3-bromo-4-methylbenzoate. InChIKey: ILZQYNXOOLMOGA-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | ethyl 3-bromo-4-methylbenzoate |
| InChIKey | ILZQYNXOOLMOGA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C)Br |
Computed by PubChem (NCBI)