cas: 137521-81-4 — see every product listed under this CAS number, including other names
Ethyl 3-chloro-4-fluorobenzoate 95% (CAS 137521-81-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A437122-5g |
| cas | 137521-81-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 693.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A437122 |
Ethyl 3-chloro-4-fluorobenzoate (CAS 137521-81-4) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: ethyl 3-chloro-4-fluorobenzoate. InChIKey: NYURFOITSAPYLU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | ethyl 3-chloro-4-fluorobenzoate |
| InChIKey | NYURFOITSAPYLU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)